C25H30ClNO2 — CID 67841656
N-benzyl-4,4-bis(4-methoxyphenyl)butan-2-amine;hydrochloride (PubChem CID 67841656) has the molecular formula C25H30ClNO2 and a molecular weight of 411.97 g/mol. Its IUPAC name is N-benzyl-4,4-bis(4-methoxyphenyl)butan-2-amine;hydrochloride.
| Compound Name | N-benzyl-4,4-bis(4-methoxyphenyl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 67841656 |
| Molecular Formula | C25H30ClNO2 |
| Molecular Weight | 411.97 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-benzyl-4,4-bis(4-methoxyphenyl)butan-2-amine;hydrochloride |
| SMILES | COc1ccc(C(CC(C)NCc2ccccc2)c2ccc(OC)cc2)cc1.Cl |
| InChI | InChI=1S/C25H29NO2.ClH/c1-19(26-18-20-7-5-4-6-8-20)17-25(21-9-13-23(27-2)14-10-21)22-11-15-24(28-3)16-12-22;/h4-16,19,25-26H,17-18H2,1-3H3;1H |
| InChIKey | LICHGHYDGLKMRJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.97 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |