C18H24ClN — CID 117066854
N-ethyl-4,4-diphenylbutan-2-amine;hydrochloride (PubChem CID 117066854) has the molecular formula C18H24ClN and a molecular weight of 289.85 g/mol. Its IUPAC name is N-ethyl-4,4-diphenylbutan-2-amine;hydrochloride.
| Compound Name | N-ethyl-4,4-diphenylbutan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 117066854 |
| Molecular Formula | C18H24ClN |
| Molecular Weight | 289.85 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-ethyl-4,4-diphenylbutan-2-amine;hydrochloride |
| SMILES | CCNC(C)CC(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C18H23N.ClH/c1-3-19-15(2)14-18(16-10-6-4-7-11-16)17-12-8-5-9-13-17;/h4-13,15,18-19H,3,14H2,1-2H3;1H |
| InChIKey | RAWUDURWJKZTBK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |