About 1-phenylethyl 3-(ethylamino)butanoate
1-phenylethyl 3-(ethylamino)butanoate (PubChem CID 62828023) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-phenylethyl 3-(ethylamino)butanoate.
Molecular Properties
| Compound Name | 1-phenylethyl 3-(ethylamino)butanoate |
| PubChem CID | 62828023 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-phenylethyl 3-(ethylamino)butanoate |
| SMILES | CCNC(C)CC(=O)OC(C)c1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-4-15-11(2)10-14(16)17-12(3)13-8-6-5-7-9-13/h5-9,11-12,15H,4,10H2,1-3H3 |
| InChIKey | JYRRMJGQNMUQLT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylethyl 3-(ethylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl 3-(ethylamino)butanoate?
The IUPAC name of 1-phenylethyl 3-(ethylamino)butanoate (CID 62828023) is 1-phenylethyl 3-(ethylamino)butanoate.
What is the SMILES notation for 1-phenylethyl 3-(ethylamino)butanoate?
The canonical SMILES for 1-phenylethyl 3-(ethylamino)butanoate is CCNC(C)CC(=O)OC(C)c1ccccc1.
What is the InChIKey of 1-phenylethyl 3-(ethylamino)butanoate?
The InChIKey is JYRRMJGQNMUQLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-4-15-11(2)10-14(16)17-12(3)13-8-6-5-7-9-13/h5-9,11-12,15H,4,10H2,1-3H3.
What are the key properties of 1-phenylethyl 3-(ethylamino)butanoate?
1-phenylethyl 3-(ethylamino)butanoate has a molecular weight of 235.33 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl 3-(ethylamino)butanoate is sourced from PubChem (CID 62828023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).