C18H23N — CID 92981582
(2S)-N-ethyl-4,4-diphenylbutan-2-amine (PubChem CID 92981582) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is (2S)-N-ethyl-4,4-diphenylbutan-2-amine.
| Compound Name | (2S)-N-ethyl-4,4-diphenylbutan-2-amine |
|---|---|
| PubChem CID | 92981582 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (2S)-N-ethyl-4,4-diphenylbutan-2-amine |
| SMILES | CCN[C@@H](C)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23N/c1-3-19-15(2)14-18(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15,18-19H,3,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | LHZORLASXUOCLW-HNNXBMFYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |