C21H23F3N6O2 — CID 123611330
5-(3-methylanilino)-7-[[1-[C-methyl-N-(2,2,2-trifluoroethyl)carbonimidoyl]cyclobutyl]amino]-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 123611330) has the molecular formula C21H23F3N6O2 and a molecular weight of 448.45 g/mol. Its IUPAC name is 5-(3-methylanilino)-7-[[1-[C-methyl-N-(2,2,2-trifluoroethyl)carbonimidoyl]cyclobutyl]amino]-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 5-(3-methylanilino)-7-[[1-[C-methyl-N-(2,2,2-trifluoroethyl)carbonimidoyl]cyclobutyl]amino]-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 123611330 |
| Molecular Formula | C21H23F3N6O2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 5-(3-methylanilino)-7-[[1-[C-methyl-N-(2,2,2-trifluoroethyl)carbonimidoyl]cyclobutyl]amino]-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | C/C(=N\CC(F)(F)F)C1(Nc2nc(Nc3cccc(C)c3)c3c(n2)OCNC3=O)CCC1 |
| InChI | InChI=1S/C21H23F3N6O2/c1-12-5-3-6-14(9-12)27-16-15-17(31)26-11-32-18(15)29-19(28-16)30-20(7-4-8-20)13(2)25-10-21(22,23)24/h3,5-6,9H,4,7-8,10-11H2,1-2H3,(H,26,31)(H2,27,28,29,30)/b25-13+ |
| InChIKey | XXUYDRUASZBGME-DHRITJCHSA-N |
| XLogP | 3.97 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|