C19H23N5O2 — CID 123907980
7-(2,3-dimethylbut-3-en-2-ylamino)-5-(3-methylanilino)-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 123907980) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 7-(2,3-dimethylbut-3-en-2-ylamino)-5-(3-methylanilino)-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 7-(2,3-dimethylbut-3-en-2-ylamino)-5-(3-methylanilino)-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 123907980 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 7-(2,3-dimethylbut-3-en-2-ylamino)-5-(3-methylanilino)-2,3-dihydropyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | C=C(C)C(C)(C)Nc1nc(Nc2cccc(C)c2)c2c(n1)OCNC2=O |
| InChI | InChI=1S/C19H23N5O2/c1-11(2)19(4,5)24-18-22-15(21-13-8-6-7-12(3)9-13)14-16(25)20-10-26-17(14)23-18/h6-9H,1,10H2,2-5H3,(H,20,25)(H2,21,22,23,24) |
| InChIKey | PSJRACFAQJOULV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|