C21H34N2O2 — CID 123611387
(3S,10R,11S,13S,17S)-17-(1-diazenylethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diol (PubChem CID 123611387) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is (3S,10R,11S,13S,17S)-17-(1-diazenylethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diol.
| Compound Name | (3S,10R,11S,13S,17S)-17-(1-diazenylethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
|---|---|
| PubChem CID | 123611387 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | (3S,10R,11S,13S,17S)-17-(1-diazenylethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
| SMILES | [H]/N=N/C(C)[C@H]1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3C(O)C[C@@]21C |
| InChI | InChI=1S/C21H34N2O2/c1-12(23-22)16-6-7-17-15-5-4-13-10-14(24)8-9-20(13,2)19(15)18(25)11-21(16,17)3/h4,12,14-19,22,24-25H,5-11H2,1-3H3/b23-22+/t12?,14-,15?,16+,17?,18?,19?,20-,21+/m0/s1 |
| InChIKey | XBADFHCMCUSAFP-ZCNFNCNLSA-N |
| XLogP | 4.32 |
| TPSA | 76.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|