C30H50O2 — CID 162853728
(3S,10R,11R,13R,17R)-10,13-dimethyl-17-[(1S)-1-[(2R)-2-methyl-2-[(2R)-3-methylbutan-2-yl]cyclopropyl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diol (PubChem CID 162853728) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is (3S,10R,11R,13R,17R)-10,13-dimethyl-17-[(1S)-1-[(2R)-2-methyl-2-[(2R)-3-methylbutan-2-yl]cyclopropyl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diol.
| Compound Name | (3S,10R,11R,13R,17R)-10,13-dimethyl-17-[(1S)-1-[(2R)-2-methyl-2-[(2R)-3-methylbutan-2-yl]cyclopropyl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
|---|---|
| PubChem CID | 162853728 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | (3S,10R,11R,13R,17R)-10,13-dimethyl-17-[(1S)-1-[(2R)-2-methyl-2-[(2R)-3-methylbutan-2-yl]cyclopropyl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
| SMILES | CC(C)[C@@H](C)[C@@]1(C)CC1[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3C(O)C[C@@]21C |
| InChI | InChI=1S/C30H50O2/c1-17(2)19(4)29(6)15-25(29)18(3)23-10-11-24-22-9-8-20-14-21(31)12-13-28(20,5)27(22)26(32)16-30(23,24)7/h8,17-19,21-27,31-32H,9-16H2,1-7H3/t18-,19+,21-,22?,23+,24?,25?,26?,27?,28-,29+,30+/m0/s1 |
| InChIKey | GXYWNVINFDDRJI-CHVFLMBMSA-N |
| XLogP | 6.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|