C31H48O3Si — CID 123612140
(9S,10R,11S,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-16-methylidene-17-[2-tri(propan-2-yl)silylethynyl]-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 123612140) has the molecular formula C31H48O3Si and a molecular weight of 496.81 g/mol. Its IUPAC name is (9S,10R,11S,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-16-methylidene-17-[2-tri(propan-2-yl)silylethynyl]-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9S,10R,11S,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-16-methylidene-17-[2-tri(propan-2-yl)silylethynyl]-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123612140 |
| Molecular Formula | C31H48O3Si |
| Molecular Weight | 496.81 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | (9S,10R,11S,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-16-methylidene-17-[2-tri(propan-2-yl)silylethynyl]-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C1C[C@H]2C3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@]2(C)[C@]1(O)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H48O3Si/c1-19(2)35(20(3)4,21(5)6)15-14-31(34)22(7)16-26-25-11-10-23-17-24(32)12-13-29(23,8)28(25)27(33)18-30(26,31)9/h17,19-21,25-28,33-34H,7,10-13,16,18H2,1-6,8-9H3/t25?,26-,27-,28+,29-,30-,31-/m0/s1 |
| InChIKey | MCPLXTCWHDEGLV-SPMUMTODSA-N |
| XLogP | 6.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.81 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|