C30H38O3Si — CID 123166384
(9S,10R,11S,13S,14S,17S)-17-[2-[dimethyl(phenyl)silyl]ethynyl]-11,17-dihydroxy-10,13-dimethyl-16-methylidene-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 123166384) has the molecular formula C30H38O3Si and a molecular weight of 474.72 g/mol. Its IUPAC name is (9S,10R,11S,13S,14S,17S)-17-[2-[dimethyl(phenyl)silyl]ethynyl]-11,17-dihydroxy-10,13-dimethyl-16-methylidene-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9S,10R,11S,13S,14S,17S)-17-[2-[dimethyl(phenyl)silyl]ethynyl]-11,17-dihydroxy-10,13-dimethyl-16-methylidene-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123166384 |
| Molecular Formula | C30H38O3Si |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (9S,10R,11S,13S,14S,17S)-17-[2-[dimethyl(phenyl)silyl]ethynyl]-11,17-dihydroxy-10,13-dimethyl-16-methylidene-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C1C[C@H]2C3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@]2(C)[C@]1(O)C#C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C30H38O3Si/c1-20-17-25-24-12-11-21-18-22(31)13-14-28(21,2)27(24)26(32)19-29(25,3)30(20,33)15-16-34(4,5)23-9-7-6-8-10-23/h6-10,18,24-27,32-33H,1,11-14,17,19H2,2-5H3/t24?,25-,26-,27+,28-,29-,30-/m0/s1 |
| InChIKey | JXWJKPSAMBIEEW-HALVSGLWSA-N |
| XLogP | 4.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|