C27H42N2O6 — CID 123612381
[(2S)-5-[[(2R,3R,5S,6S)-6-[5-[(3R,5S,7S)-7-(aminomethyl)-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 123612381) has the molecular formula C27H42N2O6 and a molecular weight of 490.64 g/mol. Its IUPAC name is [(2S)-5-[[(2R,3R,5S,6S)-6-[5-[(3R,5S,7S)-7-(aminomethyl)-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [(2S)-5-[[(2R,3R,5S,6S)-6-[5-[(3R,5S,7S)-7-(aminomethyl)-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 123612381 |
| Molecular Formula | C27H42N2O6 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | [(2S)-5-[[(2R,3R,5S,6S)-6-[5-[(3R,5S,7S)-7-(aminomethyl)-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C=CC(=O)N[C@@H]1C[C@H](C)[C@H](CC=C(C)C=C[C@@H]2C[C@]3(CO3)C[C@@H](CN)O2)O[C@@H]1C |
| InChI | InChI=1S/C27H42N2O6/c1-17(6-9-22-13-27(16-32-27)14-23(15-28)35-22)7-10-25-18(2)12-24(20(4)34-25)29-26(31)11-8-19(3)33-21(5)30/h6-9,11,18-20,22-25H,10,12-16,28H2,1-5H3,(H,29,31)/t18-,19-,20+,22+,23-,24+,25-,27+/m0/s1 |
| InChIKey | FIVPHRDLGGCZQY-VZNKNLFWSA-N |
| XLogP | 2.96 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|