C27H40N2O7 — CID 144618428
[(Z)-5-[[2,5-dimethyl-6-[(2E,4E)-3-methyl-5-[(7S)-7-(nitrosomethyl)-1,6-dioxaspiro[2.5]octan-5-yl]penta-2,4-dienyl]oxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 144618428) has the molecular formula C27H40N2O7 and a molecular weight of 504.62 g/mol. Its IUPAC name is [(Z)-5-[[2,5-dimethyl-6-[(2E,4E)-3-methyl-5-[(7S)-7-(nitrosomethyl)-1,6-dioxaspiro[2.5]octan-5-yl]penta-2,4-dienyl]oxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [(Z)-5-[[2,5-dimethyl-6-[(2E,4E)-3-methyl-5-[(7S)-7-(nitrosomethyl)-1,6-dioxaspiro[2.5]octan-5-yl]penta-2,4-dienyl]oxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 144618428 |
| Molecular Formula | C27H40N2O7 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | [(Z)-5-[[2,5-dimethyl-6-[(2E,4E)-3-methyl-5-[(7S)-7-(nitrosomethyl)-1,6-dioxaspiro[2.5]octan-5-yl]penta-2,4-dienyl]oxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CC(=O)OC(C)/C=C\C(=O)NC1CC(C)C(C/C=C(C)/C=C/C2CC3(CO3)C[C@@H](CN=O)O2)OC1C |
| InChI | InChI=1S/C27H40N2O7/c1-17(6-9-22-13-27(16-33-27)14-23(36-22)15-28-32)7-10-25-18(2)12-24(20(4)35-25)29-26(31)11-8-19(3)34-21(5)30/h6-9,11,18-20,22-25H,10,12-16H2,1-5H3,(H,29,31)/b9-6+,11-8-,17-7+/t18?,19?,20?,22?,23-,24?,25?,27?/m0/s1 |
| InChIKey | VXLOMSYGCWRILJ-KIDJYQFQSA-N |
| XLogP | 3.77 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|