C20H22N4O2S — CID 123612503
2-cyclopentyl-N-[3-(3-sulfinamoylphenyl)-1H-indazol-5-yl]acetamide (PubChem CID 123612503) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-cyclopentyl-N-[3-(3-sulfinamoylphenyl)-1H-indazol-5-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-[3-(3-sulfinamoylphenyl)-1H-indazol-5-yl]acetamide |
|---|---|
| PubChem CID | 123612503 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-cyclopentyl-N-[3-(3-sulfinamoylphenyl)-1H-indazol-5-yl]acetamide |
| SMILES | NS(=O)c1cccc(-c2n[nH]c3ccc(NC(=O)CC4CCCC4)cc23)c1 |
| InChI | InChI=1S/C20H22N4O2S/c21-27(26)16-7-3-6-14(11-16)20-17-12-15(8-9-18(17)23-24-20)22-19(25)10-13-4-1-2-5-13/h3,6-9,11-13H,1-2,4-5,10,21H2,(H,22,25)(H,23,24) |
| InChIKey | WSXGTUAKVYENFQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |