C11H20N2 — CID 123613286
N,N,3-triethyl-3,4-dihydropyridin-5-amine (PubChem CID 123613286) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is N,N,3-triethyl-3,4-dihydropyridin-5-amine.
| Compound Name | N,N,3-triethyl-3,4-dihydropyridin-5-amine |
|---|---|
| PubChem CID | 123613286 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N,N,3-triethyl-3,4-dihydropyridin-5-amine |
| SMILES | CCC1C=NC=C(N(CC)CC)C1 |
| InChI | InChI=1S/C11H20N2/c1-4-10-7-11(9-12-8-10)13(5-2)6-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | VLXAGHDUGIIMCT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |