C14H26N2 — CID 123783798
2-heptan-3-yl-4,5-dimethyl-5,6-dihydro-1,4-diazepine (PubChem CID 123783798) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 2-heptan-3-yl-4,5-dimethyl-5,6-dihydro-1,4-diazepine.
| Compound Name | 2-heptan-3-yl-4,5-dimethyl-5,6-dihydro-1,4-diazepine |
|---|---|
| PubChem CID | 123783798 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 2-heptan-3-yl-4,5-dimethyl-5,6-dihydro-1,4-diazepine |
| SMILES | CCCCC(CC)C1=CN(C)C(C)CC=N1 |
| InChI | InChI=1S/C14H26N2/c1-5-7-8-13(6-2)14-11-16(4)12(3)9-10-15-14/h10-13H,5-9H2,1-4H3 |
| InChIKey | MGNGVODFUGKEIU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |