C30H30ClN7O — CID 123613290
[2-chloro-1-[4-[(pyridin-3-ylmethylamino)methylamino]phenyl]indol-3-yl]-(4-imidazol-1-ylpiperidin-1-yl)methanone (PubChem CID 123613290) has the molecular formula C30H30ClN7O and a molecular weight of 540.07 g/mol. Its IUPAC name is [2-chloro-1-[4-[(pyridin-3-ylmethylamino)methylamino]phenyl]indol-3-yl]-(4-imidazol-1-ylpiperidin-1-yl)methanone.
| Compound Name | [2-chloro-1-[4-[(pyridin-3-ylmethylamino)methylamino]phenyl]indol-3-yl]-(4-imidazol-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 123613290 |
| Molecular Formula | C30H30ClN7O |
| Molecular Weight | 540.07 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | [2-chloro-1-[4-[(pyridin-3-ylmethylamino)methylamino]phenyl]indol-3-yl]-(4-imidazol-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1c(Cl)n(-c2ccc(NCNCc3cccnc3)cc2)c2ccccc12)N1CCC(n2ccnc2)CC1 |
| InChI | InChI=1S/C30H30ClN7O/c31-29-28(30(39)36-15-11-24(12-16-36)37-17-14-33-21-37)26-5-1-2-6-27(26)38(29)25-9-7-23(8-10-25)35-20-34-19-22-4-3-13-32-18-22/h1-10,13-14,17-18,21,24,34-35H,11-12,15-16,19-20H2 |
| InChIKey | FSCCKAFRISSHJG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.07 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|