C12H19N — CID 123613294
N-[(1Z)-nona-1,3,7-trienyl]propan-2-imine (PubChem CID 123613294) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-[(1Z)-nona-1,3,7-trienyl]propan-2-imine.
| Compound Name | N-[(1Z)-nona-1,3,7-trienyl]propan-2-imine |
|---|---|
| PubChem CID | 123613294 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-[(1Z)-nona-1,3,7-trienyl]propan-2-imine |
| SMILES | CC=CCCC=C/C=C\N=C(C)C |
| InChI | InChI=1S/C12H19N/c1-4-5-6-7-8-9-10-11-13-12(2)3/h4-5,8-11H,6-7H2,1-3H3/b5-4?,9-8?,11-10- |
| InChIKey | WSZRUABNXOYCLW-XABRWVDCSA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|