C33H43F3N4O6S — CID 123613635
methyl N-[1-(2,6-dimethyloxan-4-yl)-3-[2-[2-(2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3,6-difluoroanilino]-1-(4-fluorophenyl)-3-oxopropan-2-yl]carbamate (PubChem CID 123613635) has the molecular formula C33H43F3N4O6S and a molecular weight of 680.79 g/mol. Its IUPAC name is methyl N-[1-(2,6-dimethyloxan-4-yl)-3-[2-[2-(2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3,6-difluoroanilino]-1-(4-fluorophenyl)-3-oxopropan-2-yl]carbamate.
| Compound Name | methyl N-[1-(2,6-dimethyloxan-4-yl)-3-[2-[2-(2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3,6-difluoroanilino]-1-(4-fluorophenyl)-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 123613635 |
| Molecular Formula | C33H43F3N4O6S |
| Molecular Weight | 680.79 g/mol |
| Exact Mass | 680.29 |
| IUPAC Name | methyl N-[1-(2,6-dimethyloxan-4-yl)-3-[2-[2-(2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3,6-difluoroanilino]-1-(4-fluorophenyl)-3-oxopropan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)Nc1c(F)ccc(F)c1CCC1CNC2CCCS(=O)(=O)N1C2)C(c1ccc(F)cc1)C1CC(C)OC(C)C1 |
| InChI | InChI=1S/C33H43F3N4O6S/c1-19-15-22(16-20(2)46-19)29(21-6-8-23(34)9-7-21)31(39-33(42)45-3)32(41)38-30-26(27(35)12-13-28(30)36)11-10-25-17-37-24-5-4-14-47(43,44)40(25)18-24/h6-9,12-13,19-20,22,24-25,29,31,37H,4-5,10-11,14-18H2,1-3H3,(H,38,41)(H,39,42) |
| InChIKey | NLZWLNSAPIGFQH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |