C31H39ClF2N4O6S — CID 118374458
methyl N-[(1R,2S)-1-(4-chlorophenyl)-3-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,6-difluoroanilino]-1-(oxan-4-yl)-3-oxopropan-2-yl]carbamate (PubChem CID 118374458) has the molecular formula C31H39ClF2N4O6S and a molecular weight of 669.19 g/mol. Its IUPAC name is methyl N-[(1R,2S)-1-(4-chlorophenyl)-3-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,6-difluoroanilino]-1-(oxan-4-yl)-3-oxopropan-2-yl]carbamate.
| Compound Name | methyl N-[(1R,2S)-1-(4-chlorophenyl)-3-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,6-difluoroanilino]-1-(oxan-4-yl)-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 118374458 |
| Molecular Formula | C31H39ClF2N4O6S |
| Molecular Weight | 669.19 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | methyl N-[(1R,2S)-1-(4-chlorophenyl)-3-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,6-difluoroanilino]-1-(oxan-4-yl)-3-oxopropan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)Nc1c(F)ccc(F)c1CC[C@H]1CN[C@@H]2CCCS(=O)(=O)N1C2)[C@@H](c1ccc(Cl)cc1)C1CCOCC1 |
| InChI | InChI=1S/C31H39ClF2N4O6S/c1-43-31(40)37-29(27(20-12-14-44-15-13-20)19-4-6-21(32)7-5-19)30(39)36-28-24(25(33)10-11-26(28)34)9-8-23-17-35-22-3-2-16-45(41,42)38(23)18-22/h4-7,10-11,20,22-23,27,29,35H,2-3,8-9,12-18H2,1H3,(H,36,39)(H,37,40)/t22-,23+,27+,29+/m1/s1 |
| InChIKey | XMAJFLGFLWVMLM-GPJNXOPYSA-N |
| XLogP | 4.19 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |