C30H37ClF2N4O6S — CID 138541384
[1-(4-chlorophenyl)-3-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,5-difluoroanilino]-1-(oxan-4-yl)-3-oxopropan-2-yl]carbamic acid (PubChem CID 138541384) has the molecular formula C30H37ClF2N4O6S and a molecular weight of 655.16 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-3-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,5-difluoroanilino]-1-(oxan-4-yl)-3-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-(4-chlorophenyl)-3-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,5-difluoroanilino]-1-(oxan-4-yl)-3-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 138541384 |
| Molecular Formula | C30H37ClF2N4O6S |
| Molecular Weight | 655.16 g/mol |
| Exact Mass | 654.21 |
| IUPAC Name | [1-(4-chlorophenyl)-3-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,5-difluoroanilino]-1-(oxan-4-yl)-3-oxopropan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(C(=O)Nc1cc(F)cc(F)c1CC[C@H]1CN[C@@H]2CCCS(=O)(=O)N1C2)C(c1ccc(Cl)cc1)C1CCOCC1 |
| InChI | InChI=1S/C30H37ClF2N4O6S/c31-20-5-3-18(4-6-20)27(19-9-11-43-12-10-19)28(36-30(39)40)29(38)35-26-15-21(32)14-25(33)24(26)8-7-23-16-34-22-2-1-13-44(41,42)37(23)17-22/h3-6,14-15,19,22-23,27-28,34,36H,1-2,7-13,16-17H2,(H,35,38)(H,39,40)/t22-,23+,27?,28?/m1/s1 |
| InChIKey | XXOQLKUXCFGXMT-VIOUFKKBSA-N |
| XLogP | 4.10 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |