C30H38ClF2N3O4S — CID 148762100
(3S,4R)-3-amino-4-(4-chlorophenyl)-1-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,6-difluorophenyl]-4-(oxan-4-yl)butan-2-one (PubChem CID 148762100) has the molecular formula C30H38ClF2N3O4S and a molecular weight of 610.17 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-(4-chlorophenyl)-1-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,6-difluorophenyl]-4-(oxan-4-yl)butan-2-one.
| Compound Name | (3S,4R)-3-amino-4-(4-chlorophenyl)-1-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,6-difluorophenyl]-4-(oxan-4-yl)butan-2-one |
|---|---|
| PubChem CID | 148762100 |
| Molecular Formula | C30H38ClF2N3O4S |
| Molecular Weight | 610.17 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | (3S,4R)-3-amino-4-(4-chlorophenyl)-1-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3,6-difluorophenyl]-4-(oxan-4-yl)butan-2-one |
| SMILES | N[C@H](C(=O)Cc1c(F)ccc(F)c1CC[C@H]1CN[C@@H]2CCCS(=O)(=O)N1C2)[C@@H](c1ccc(Cl)cc1)C1CCOCC1 |
| InChI | InChI=1S/C30H38ClF2N3O4S/c31-21-5-3-19(4-6-21)29(20-11-13-40-14-12-20)30(34)28(37)16-25-24(26(32)9-10-27(25)33)8-7-23-17-35-22-2-1-15-41(38,39)36(23)18-22/h3-6,9-10,20,22-23,29-30,35H,1-2,7-8,11-18,34H2/t22-,23+,29+,30-/m1/s1 |
| InChIKey | OGTKFSCHYHBFEW-UEABVZRBSA-N |
| XLogP | 3.97 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.17 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |