C30H47ClN4O4S — CID 138547178
(2S)-2-amino-3-(4-chlorophenyl)-N-[(1S,2R)-2-[3-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]propyl]cyclohexyl]-3-(oxan-4-yl)propanamide (PubChem CID 138547178) has the molecular formula C30H47ClN4O4S and a molecular weight of 595.25 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-chlorophenyl)-N-[(1S,2R)-2-[3-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]propyl]cyclohexyl]-3-(oxan-4-yl)propanamide.
| Compound Name | (2S)-2-amino-3-(4-chlorophenyl)-N-[(1S,2R)-2-[3-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]propyl]cyclohexyl]-3-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 138547178 |
| Molecular Formula | C30H47ClN4O4S |
| Molecular Weight | 595.25 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | (2S)-2-amino-3-(4-chlorophenyl)-N-[(1S,2R)-2-[3-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]propyl]cyclohexyl]-3-(oxan-4-yl)propanamide |
| SMILES | N[C@H](C(=O)N[C@H]1CCCC[C@@H]1CCC[C@H]1CN[C@@H]2CCCS(=O)(=O)N1C2)C(c1ccc(Cl)cc1)C1CCOCC1 |
| InChI | InChI=1S/C30H47ClN4O4S/c31-24-12-10-22(11-13-24)28(23-14-16-39-17-15-23)29(32)30(36)34-27-9-2-1-5-21(27)6-3-8-26-19-33-25-7-4-18-40(37,38)35(26)20-25/h10-13,21,23,25-29,33H,1-9,14-20,32H2,(H,34,36)/t21-,25-,26+,27+,28?,29+/m1/s1 |
| InChIKey | HSAIIMYKCSQJTI-BJHCYWHJSA-N |
| XLogP | 3.79 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |