C29H40ClN5O4S — CID 138541236
2-amino-3-(4-chlorophenyl)-N-[(1S,2R)-2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclopentyl]-3-(6-methoxy-3-pyridinyl)propanamide (PubChem CID 138541236) has the molecular formula C29H40ClN5O4S and a molecular weight of 590.19 g/mol. Its IUPAC name is 2-amino-3-(4-chlorophenyl)-N-[(1S,2R)-2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclopentyl]-3-(6-methoxy-3-pyridinyl)propanamide.
| Compound Name | 2-amino-3-(4-chlorophenyl)-N-[(1S,2R)-2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclopentyl]-3-(6-methoxy-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 138541236 |
| Molecular Formula | C29H40ClN5O4S |
| Molecular Weight | 590.19 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | 2-amino-3-(4-chlorophenyl)-N-[(1S,2R)-2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclopentyl]-3-(6-methoxy-3-pyridinyl)propanamide |
| SMILES | COc1ccc(C(c2ccc(Cl)cc2)C(N)C(=O)N[C@H]2CCC[C@@H]2CC[C@H]2CN[C@@H]3CCCS(=O)(=O)N2C3)cn1 |
| InChI | InChI=1S/C29H40ClN5O4S/c1-39-26-14-10-21(16-33-26)27(20-7-11-22(30)12-8-20)28(31)29(36)34-25-6-2-4-19(25)9-13-24-17-32-23-5-3-15-40(37,38)35(24)18-23/h7-8,10-12,14,16,19,23-25,27-28,32H,2-6,9,13,15,17-18,31H2,1H3,(H,34,36)/t19-,23-,24+,25+,27?,28?/m1/s1 |
| InChIKey | OUWKLMIEEOPGPV-IOGPRTIOSA-N |
| XLogP | 3.03 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |