C32H50ClN3O4S — CID 147228375
(3S,4R)-3-amino-4-(4-chlorophenyl)-1-[(1R,2R)-2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclohexyl]-4-(4-methoxycyclohexyl)butan-2-one (PubChem CID 147228375) has the molecular formula C32H50ClN3O4S and a molecular weight of 608.29 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-(4-chlorophenyl)-1-[(1R,2R)-2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclohexyl]-4-(4-methoxycyclohexyl)butan-2-one.
| Compound Name | (3S,4R)-3-amino-4-(4-chlorophenyl)-1-[(1R,2R)-2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclohexyl]-4-(4-methoxycyclohexyl)butan-2-one |
|---|---|
| PubChem CID | 147228375 |
| Molecular Formula | C32H50ClN3O4S |
| Molecular Weight | 608.29 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | (3S,4R)-3-amino-4-(4-chlorophenyl)-1-[(1R,2R)-2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]cyclohexyl]-4-(4-methoxycyclohexyl)butan-2-one |
| SMILES | COC1CCC([C@H](c2ccc(Cl)cc2)[C@H](N)C(=O)C[C@H]2CCCC[C@@H]2CC[C@H]2CN[C@@H]3CCCS(=O)(=O)N2C3)CC1 |
| InChI | InChI=1S/C32H50ClN3O4S/c1-40-29-16-11-24(12-17-29)31(23-8-13-26(33)14-9-23)32(34)30(37)19-25-6-3-2-5-22(25)10-15-28-20-35-27-7-4-18-41(38,39)36(28)21-27/h8-9,13-14,22,24-25,27-29,31-32,35H,2-7,10-12,15-21,34H2,1H3/t22-,24?,25-,27-,28+,29?,31+,32-/m1/s1 |
| InChIKey | CIKMJZZCLPVIOT-KBERMQKLSA-N |
| XLogP | 5.27 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.29 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |