C16H27N3O — CID 123613729
2,2-dimethyl-5-methylimino-N-(2-methyliminohex-5-en-3-yl)hex-3-enamide (PubChem CID 123613729) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 2,2-dimethyl-5-methylimino-N-(2-methyliminohex-5-en-3-yl)hex-3-enamide.
| Compound Name | 2,2-dimethyl-5-methylimino-N-(2-methyliminohex-5-en-3-yl)hex-3-enamide |
|---|---|
| PubChem CID | 123613729 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 2,2-dimethyl-5-methylimino-N-(2-methyliminohex-5-en-3-yl)hex-3-enamide |
| SMILES | C=CCC(NC(=O)C(C)(C)C=C/C(C)=N/C)/C(C)=N/C |
| InChI | InChI=1S/C16H27N3O/c1-8-9-14(13(3)18-7)19-15(20)16(4,5)11-10-12(2)17-6/h8,10-11,14H,1,9H2,2-7H3,(H,19,20)/b11-10?,17-12+,18-13+ |
| InChIKey | AHODWMSMWKGVQZ-AAEJVYRUSA-N |
| XLogP | 2.81 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|