C13H22N2O — CID 137466839
N-[(3S,5E)-4-iminonona-5,8-dien-3-yl]-N-methylpropanamide (PubChem CID 137466839) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-[(3S,5E)-4-iminonona-5,8-dien-3-yl]-N-methylpropanamide.
| Compound Name | N-[(3S,5E)-4-iminonona-5,8-dien-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 137466839 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-[(3S,5E)-4-iminonona-5,8-dien-3-yl]-N-methylpropanamide |
| SMILES | [H]/N=C(\C=C\CC=C)[C@H](CC)N(C)C(=O)CC |
| InChI | InChI=1S/C13H22N2O/c1-5-8-9-10-11(14)12(6-2)15(4)13(16)7-3/h5,9-10,12,14H,1,6-8H2,2-4H3/b10-9+,14-11+/t12-/m0/s1 |
| InChIKey | BOLVWWBYXIDLNW-XRNFIJDDSA-N |
| XLogP | 2.79 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|