C11H19N3O — CID 145282443
(Z)-N-ethyl-2,5-diimino-N-propan-2-ylhex-3-enamide (PubChem CID 145282443) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is (Z)-N-ethyl-2,5-diimino-N-propan-2-ylhex-3-enamide.
| Compound Name | (Z)-N-ethyl-2,5-diimino-N-propan-2-ylhex-3-enamide |
|---|---|
| PubChem CID | 145282443 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | (Z)-N-ethyl-2,5-diimino-N-propan-2-ylhex-3-enamide |
| SMILES | [H]/N=C(/C=C\C(C)=N\[H])C(=O)N(CC)C(C)C |
| InChI | InChI=1S/C11H19N3O/c1-5-14(8(2)3)11(15)10(13)7-6-9(4)12/h6-8,12-13H,5H2,1-4H3/b7-6-,12-9+,13-10- |
| InChIKey | AFWANDZWNBRRAV-HRVCFGKZSA-N |
| XLogP | 1.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|