C30H32N2O4 — CID 123614354
[2-[2,7-dimethyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]-2-(2-methylbutan-2-yloxy)ethyl] formate (PubChem CID 123614354) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is [2-[2,7-dimethyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]-2-(2-methylbutan-2-yloxy)ethyl] formate.
| Compound Name | [2-[2,7-dimethyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]-2-(2-methylbutan-2-yloxy)ethyl] formate |
|---|---|
| PubChem CID | 123614354 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | [2-[2,7-dimethyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]-2-(2-methylbutan-2-yloxy)ethyl] formate |
| SMILES | CCC(C)(C)OC(COC=O)c1c(C)cc2nc(C)ccc2c1-c1ccc2c3c(ccnc13)CCO2 |
| InChI | InChI=1S/C30H32N2O4/c1-6-30(4,5)36-25(16-34-17-33)26-18(2)15-23-21(8-7-19(3)32-23)28(26)22-9-10-24-27-20(12-14-35-24)11-13-31-29(22)27/h7-11,13,15,17,25H,6,12,14,16H2,1-5H3 |
| InChIKey | XBAOMTJRCSEWPU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|