C13H28O5S — CID 123615001
[4-(3-methoxy-3-methylbutoxy)-3,3-dimethylbutyl] methanesulfonate (PubChem CID 123615001) has the molecular formula C13H28O5S and a molecular weight of 296.43 g/mol. Its IUPAC name is [4-(3-methoxy-3-methylbutoxy)-3,3-dimethylbutyl] methanesulfonate.
| Compound Name | [4-(3-methoxy-3-methylbutoxy)-3,3-dimethylbutyl] methanesulfonate |
|---|---|
| PubChem CID | 123615001 |
| Molecular Formula | C13H28O5S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | [4-(3-methoxy-3-methylbutoxy)-3,3-dimethylbutyl] methanesulfonate |
| SMILES | COC(C)(C)CCOCC(C)(C)CCOS(C)(=O)=O |
| InChI | InChI=1S/C13H28O5S/c1-12(2,7-10-18-19(6,14)15)11-17-9-8-13(3,4)16-5/h7-11H2,1-6H3 |
| InChIKey | PBHIQVADDQAWEW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|