C14H16N4O4 — CID 123615294
(2,5-dihydroxypyrrol-1-yl) 2-(4,5,8,9-tetrahydrocycloocta[d]triazol-3-yl)acetate (PubChem CID 123615294) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(4,5,8,9-tetrahydrocycloocta[d]triazol-3-yl)acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(4,5,8,9-tetrahydrocycloocta[d]triazol-3-yl)acetate |
|---|---|
| PubChem CID | 123615294 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(4,5,8,9-tetrahydrocycloocta[d]triazol-3-yl)acetate |
| SMILES | O=C(Cn1nnc2c1CCC=CCC2)On1c(O)ccc1O |
| InChI | InChI=1S/C14H16N4O4/c19-12-7-8-13(20)18(12)22-14(21)9-17-11-6-4-2-1-3-5-10(11)15-16-17/h1-2,7-8,19-20H,3-6,9H2 |
| InChIKey | ZEKBNHNXXNPCPG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|