C14H18N4O4 — CID 123261239
(2,5-dihydroxypyrrol-1-yl) 2-[(6E)-3a,4,5,8,9,9a-hexahydrocycloocta[d]triazol-3-yl]acetate (PubChem CID 123261239) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[(6E)-3a,4,5,8,9,9a-hexahydrocycloocta[d]triazol-3-yl]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[(6E)-3a,4,5,8,9,9a-hexahydrocycloocta[d]triazol-3-yl]acetate |
|---|---|
| PubChem CID | 123261239 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[(6E)-3a,4,5,8,9,9a-hexahydrocycloocta[d]triazol-3-yl]acetate |
| SMILES | O=C(CN1N=NC2CC/C=C\CCC21)On1c(O)ccc1O |
| InChI | InChI=1S/C14H18N4O4/c19-12-7-8-13(20)18(12)22-14(21)9-17-11-6-4-2-1-3-5-10(11)15-16-17/h1-2,7-8,10-11,19-20H,3-6,9H2/b2-1- |
| InChIKey | DNWPLURPESJPAB-UPHRSURJSA-N |
| XLogP | 1.40 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|