C15H19N3O5 — CID 123930671
(2,5-dihydroxypyrrol-1-yl) 2-(2-oxo-3a,4,5,8,9,9a-hexahydro-1H-cycloocta[d]imidazol-3-yl)acetate (PubChem CID 123930671) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(2-oxo-3a,4,5,8,9,9a-hexahydro-1H-cycloocta[d]imidazol-3-yl)acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-oxo-3a,4,5,8,9,9a-hexahydro-1H-cycloocta[d]imidazol-3-yl)acetate |
|---|---|
| PubChem CID | 123930671 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-oxo-3a,4,5,8,9,9a-hexahydro-1H-cycloocta[d]imidazol-3-yl)acetate |
| SMILES | O=C(CN1C(=O)NC2CCC=CCCC21)On1c(O)ccc1O |
| InChI | InChI=1S/C15H19N3O5/c19-12-7-8-13(20)18(12)23-14(21)9-17-11-6-4-2-1-3-5-10(11)16-15(17)22/h1-2,7-8,10-11,19-20H,3-6,9H2,(H,16,22) |
| InChIKey | YZVGTFJOPQYZHH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|