C21H34N4O6 — CID 123790119
(2,5-dihydroxypyrrol-1-yl) 6-[6-(3,5-dimethyl-2-oxoimidazolidin-4-yl)hexanoylamino]hexanoate (PubChem CID 123790119) has the molecular formula C21H34N4O6 and a molecular weight of 438.53 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[6-(3,5-dimethyl-2-oxoimidazolidin-4-yl)hexanoylamino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[6-(3,5-dimethyl-2-oxoimidazolidin-4-yl)hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 123790119 |
| Molecular Formula | C21H34N4O6 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[6-(3,5-dimethyl-2-oxoimidazolidin-4-yl)hexanoylamino]hexanoate |
| SMILES | CC1NC(=O)N(C)C1CCCCCC(=O)NCCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C21H34N4O6/c1-15-16(24(2)21(30)23-15)9-5-3-6-10-17(26)22-14-8-4-7-11-20(29)31-25-18(27)12-13-19(25)28/h12-13,15-16,27-28H,3-11,14H2,1-2H3,(H,22,26)(H,23,30) |
| InChIKey | BQPFEJDDMCAGGI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|