C46H81N3O6 — CID 91125260
(2,5-dihydroxypyrrol-1-yl) 2,6-bis(octadec-9-enoylamino)hexanoate (PubChem CID 91125260) has the molecular formula C46H81N3O6 and a molecular weight of 772.17 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2,6-bis(octadec-9-enoylamino)hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2,6-bis(octadec-9-enoylamino)hexanoate |
|---|---|
| PubChem CID | 91125260 |
| Molecular Formula | C46H81N3O6 |
| Molecular Weight | 772.17 g/mol |
| Exact Mass | 771.61 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2,6-bis(octadec-9-enoylamino)hexanoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCCCC(NC(=O)CCCCCCCC=CCCCCCCCC)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C46H81N3O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-42(50)47-40-34-33-35-41(46(54)55-49-44(52)38-39-45(49)53)48-43(51)37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,38-39,41,52-53H,3-16,21-37,40H2,1-2H3,(H,47,50)(H,48,51) |
| InChIKey | CCPXLHHINDISKK-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.17 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|