C14H22N4O5 — CID 90804640
(2,5-dihydroxypyrrol-1-yl) N-[(1R)-2-methyl-1-(pyrrolidine-2-carbonylamino)propyl]carbamate (PubChem CID 90804640) has the molecular formula C14H22N4O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) N-[(1R)-2-methyl-1-(pyrrolidine-2-carbonylamino)propyl]carbamate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) N-[(1R)-2-methyl-1-(pyrrolidine-2-carbonylamino)propyl]carbamate |
|---|---|
| PubChem CID | 90804640 |
| Molecular Formula | C14H22N4O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) N-[(1R)-2-methyl-1-(pyrrolidine-2-carbonylamino)propyl]carbamate |
| SMILES | CC(C)[C@@H](NC(=O)On1c(O)ccc1O)NC(=O)C1CCCN1 |
| InChI | InChI=1S/C14H22N4O5/c1-8(2)12(16-13(21)9-4-3-7-15-9)17-14(22)23-18-10(19)5-6-11(18)20/h5-6,8-9,12,15,19-20H,3-4,7H2,1-2H3,(H,16,21)(H,17,22)/t9?,12-/m1/s1 |
| InChIKey | DMWUAJLMSWTIHO-FFFFSGIJSA-N |
| XLogP | -0.11 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|