C15H23N3O5 — CID 123779721
(2,5-dihydroxypyrrol-1-yl) 6-[(4R,5S)-3,5-dimethyl-2-oxoimidazolidin-4-yl]hexanoate (PubChem CID 123779721) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[(4R,5S)-3,5-dimethyl-2-oxoimidazolidin-4-yl]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[(4R,5S)-3,5-dimethyl-2-oxoimidazolidin-4-yl]hexanoate |
|---|---|
| PubChem CID | 123779721 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[(4R,5S)-3,5-dimethyl-2-oxoimidazolidin-4-yl]hexanoate |
| SMILES | C[C@@H]1NC(=O)N(C)[C@@H]1CCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H23N3O5/c1-10-11(17(2)15(22)16-10)6-4-3-5-7-14(21)23-18-12(19)8-9-13(18)20/h8-11,19-20H,3-7H2,1-2H3,(H,16,22)/t10-,11+/m0/s1 |
| InChIKey | LFBRVKUEBSKLJQ-WDEREUQCSA-N |
| XLogP | 1.22 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|