C18H30N2O5 — CID 54454678
2-[3-(2,5-dihydroxypyrrol-1-yl)oct-1-en-2-yl-hydroxyamino]-2-ethylbutanoic acid (PubChem CID 54454678) has the molecular formula C18H30N2O5 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[3-(2,5-dihydroxypyrrol-1-yl)oct-1-en-2-yl-hydroxyamino]-2-ethylbutanoic acid.
| Compound Name | 2-[3-(2,5-dihydroxypyrrol-1-yl)oct-1-en-2-yl-hydroxyamino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 54454678 |
| Molecular Formula | C18H30N2O5 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-[3-(2,5-dihydroxypyrrol-1-yl)oct-1-en-2-yl-hydroxyamino]-2-ethylbutanoic acid |
| SMILES | C=C(C(CCCCC)n1c(O)ccc1O)N(O)C(CC)(CC)C(=O)O |
| InChI | InChI=1S/C18H30N2O5/c1-5-8-9-10-14(19-15(21)11-12-16(19)22)13(4)20(25)18(6-2,7-3)17(23)24/h11-12,14,21-22,25H,4-10H2,1-3H3,(H,23,24) |
| InChIKey | WXIOEJIYKCRTKP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|