C22H38N2O5 — CID 54343922
2-[3-(2,5-dihydroxypyrrol-1-yl)dodec-1-en-2-yl-hydroxyamino]-2-ethylbutanoic acid (PubChem CID 54343922) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[3-(2,5-dihydroxypyrrol-1-yl)dodec-1-en-2-yl-hydroxyamino]-2-ethylbutanoic acid.
| Compound Name | 2-[3-(2,5-dihydroxypyrrol-1-yl)dodec-1-en-2-yl-hydroxyamino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 54343922 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 2-[3-(2,5-dihydroxypyrrol-1-yl)dodec-1-en-2-yl-hydroxyamino]-2-ethylbutanoic acid |
| SMILES | C=C(C(CCCCCCCCC)n1c(O)ccc1O)N(O)C(CC)(CC)C(=O)O |
| InChI | InChI=1S/C22H38N2O5/c1-5-8-9-10-11-12-13-14-18(23-19(25)15-16-20(23)26)17(4)24(29)22(6-2,7-3)21(27)28/h15-16,18,25-26,29H,4-14H2,1-3H3,(H,27,28) |
| InChIKey | UAXZXXZJRLXCBC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|