C12H20N2O4 — CID 91532803
(2,5-dihydroxypyrrol-1-yl) 2-[di(propan-2-yl)amino]acetate (PubChem CID 91532803) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[di(propan-2-yl)amino]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[di(propan-2-yl)amino]acetate |
|---|---|
| PubChem CID | 91532803 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[di(propan-2-yl)amino]acetate |
| SMILES | CC(C)N(CC(=O)On1c(O)ccc1O)C(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-8(2)13(9(3)4)7-12(17)18-14-10(15)5-6-11(14)16/h5-6,8-9,15-16H,7H2,1-4H3 |
| InChIKey | JHXKSJHFQJJHLT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |