C9H16N3O3+ — CID 54294914
[(2,5-dihydroxypyrrol-1-yl)oxy-(dimethylamino)methylidene]-dimethylazanium (PubChem CID 54294914) has the molecular formula C9H16N3O3+ and a molecular weight of 214.25 g/mol. Its IUPAC name is [(2,5-dihydroxypyrrol-1-yl)oxy-(dimethylamino)methylidene]-dimethylazanium.
| Compound Name | [(2,5-dihydroxypyrrol-1-yl)oxy-(dimethylamino)methylidene]-dimethylazanium |
|---|---|
| PubChem CID | 54294914 |
| Molecular Formula | C9H16N3O3+ |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | [(2,5-dihydroxypyrrol-1-yl)oxy-(dimethylamino)methylidene]-dimethylazanium |
| SMILES | CN(C)C(On1c(O)ccc1O)=[N+](C)C |
| InChI | InChI=1S/C9H15N3O3/c1-10(2)9(11(3)4)15-12-7(13)5-6-8(12)14/h5-6H,1-4H3,(H-,13,14)/p+1 |
| InChIKey | SACZFEPMZLHARV-UHFFFAOYSA-O |
| XLogP | -0.48 |
| TPSA | 60.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|