C20H31N5O10 — CID 90779802
2-[4,10-bis(carboxymethyl)-7-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 90779802) has the molecular formula C20H31N5O10 and a molecular weight of 501.49 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 90779802 |
| Molecular Formula | C20H31N5O10 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)On2c(O)ccc2O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H31N5O10/c26-15-1-2-16(27)25(15)35-20(34)14-24-9-7-22(12-18(30)31)5-3-21(11-17(28)29)4-6-23(8-10-24)13-19(32)33/h1-2,26-27H,3-14H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | ZGDCJGRULNMMFL-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 196.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |