C13H15F2NO — CID 123616336
3-(2,3-difluorophenyl)-1-propan-2-ylpyrrolidin-2-one (PubChem CID 123616336) has the molecular formula C13H15F2NO and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-1-propan-2-ylpyrrolidin-2-one.
| Compound Name | 3-(2,3-difluorophenyl)-1-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 123616336 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-(2,3-difluorophenyl)-1-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)N1CCC(c2cccc(F)c2F)C1=O |
| InChI | InChI=1S/C13H15F2NO/c1-8(2)16-7-6-10(13(16)17)9-4-3-5-11(14)12(9)15/h3-5,8,10H,6-7H2,1-2H3 |
| InChIKey | XBRXDKPTFFLNBK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |