C28H39N6O8P — CID 123617386
[(1R)-3-(4-butoxycarbonylpiperazin-1-yl)-1-[[6-[(3S)-3-methoxypyrrolidin-1-yl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphonic acid (PubChem CID 123617386) has the molecular formula C28H39N6O8P and a molecular weight of 618.63 g/mol. Its IUPAC name is [(1R)-3-(4-butoxycarbonylpiperazin-1-yl)-1-[[6-[(3S)-3-methoxypyrrolidin-1-yl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphonic acid.
| Compound Name | [(1R)-3-(4-butoxycarbonylpiperazin-1-yl)-1-[[6-[(3S)-3-methoxypyrrolidin-1-yl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphonic acid |
|---|---|
| PubChem CID | 123617386 |
| Molecular Formula | C28H39N6O8P |
| Molecular Weight | 618.63 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | [(1R)-3-(4-butoxycarbonylpiperazin-1-yl)-1-[[6-[(3S)-3-methoxypyrrolidin-1-yl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphonic acid |
| SMILES | CCCCOC(=O)N1CCN(C(=O)C[C@H](NC(=O)c2cc(N3CC[C@H](OC)C3)nc(-c3ccccc3)n2)P(=O)(O)O)CC1 |
| InChI | InChI=1S/C28H39N6O8P/c1-3-4-16-42-28(37)33-14-12-32(13-15-33)25(35)18-24(43(38,39)40)31-27(36)22-17-23(34-11-10-21(19-34)41-2)30-26(29-22)20-8-6-5-7-9-20/h5-9,17,21,24H,3-4,10-16,18-19H2,1-2H3,(H,31,36)(H2,38,39,40)/t21-,24+/m0/s1 |
| InChIKey | MBONPQMXTWJYHU-XUZZJYLKSA-N |
| XLogP | 2.07 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.63 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|