C35H47N6O11P — CID 87416103
CID 87416103 (PubChem CID 87416103) has the molecular formula C35H47N6O11P and a molecular weight of 758.77 g/mol.
| Compound Name | CID 87416103 |
|---|---|
| PubChem CID | 87416103 |
| Molecular Formula | C35H47N6O11P |
| Molecular Weight | 758.77 g/mol |
| Exact Mass | 758.30 |
| IUPAC Name | — |
| SMILES | CCCCOC(=O)N1CCN(C(=O)[C@H](/C=[P+](\[O-])OC(OC(=O)CC)OC(=O)CC)NC(=O)c2cc(N3CC[C@H](OC)C3)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C35H47N6O11P/c1-5-8-20-49-34(46)40-18-16-39(17-19-40)33(45)27(23-53(47)52-35(50-29(42)6-2)51-30(43)7-3)37-32(44)26-21-28(41-15-14-25(22-41)48-4)38-31(36-26)24-12-10-9-11-13-24/h9-13,21,23,25,27,35H,5-8,14-20,22H2,1-4H3,(H,37,44)/t25-,27-/m0/s1 |
| InChIKey | SKPOMRGCFYKOJR-BDYUSTAISA-N |
| XLogP | 2.23 |
| TPSA | 202.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.77 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|