C12H17F4N3 — CID 123617855
2-fluoro-N'-[(E)-6,6,6-trifluoro-5-imino-2-methylhex-2-enyl]pent-2-enimidamide (PubChem CID 123617855) has the molecular formula C12H17F4N3 and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-fluoro-N'-[(E)-6,6,6-trifluoro-5-imino-2-methylhex-2-enyl]pent-2-enimidamide.
| Compound Name | 2-fluoro-N'-[(E)-6,6,6-trifluoro-5-imino-2-methylhex-2-enyl]pent-2-enimidamide |
|---|---|
| PubChem CID | 123617855 |
| Molecular Formula | C12H17F4N3 |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-fluoro-N'-[(E)-6,6,6-trifluoro-5-imino-2-methylhex-2-enyl]pent-2-enimidamide |
| SMILES | [H]/N=C(\C/C=C(\C)C/N=C(\N)C(F)=CCC)C(F)(F)F |
| InChI | InChI=1S/C12H17F4N3/c1-3-4-9(13)11(18)19-7-8(2)5-6-10(17)12(14,15)16/h4-5,17H,3,6-7H2,1-2H3,(H2,18,19)/b8-5+,9-4?,17-10+ |
| InChIKey | ZEXDDNODRDYTGG-LLLZQTCCSA-N |
| XLogP | 3.53 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|