C9H16F2N2 — CID 169247325
(E)-N'-(2,2-difluoroethyl)-3-methylhex-2-enimidamide (PubChem CID 169247325) has the molecular formula C9H16F2N2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (E)-N'-(2,2-difluoroethyl)-3-methylhex-2-enimidamide.
| Compound Name | (E)-N'-(2,2-difluoroethyl)-3-methylhex-2-enimidamide |
|---|---|
| PubChem CID | 169247325 |
| Molecular Formula | C9H16F2N2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (E)-N'-(2,2-difluoroethyl)-3-methylhex-2-enimidamide |
| SMILES | CCC/C(C)=C/C(N)=N/CC(F)F |
| InChI | InChI=1S/C9H16F2N2/c1-3-4-7(2)5-9(12)13-6-8(10)11/h5,8H,3-4,6H2,1-2H3,(H2,12,13)/b7-5+ |
| InChIKey | HNBMEBNLFZPHQW-FNORWQNLSA-N |
| XLogP | 2.36 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|