C11H20F2N2 — CID 169247287
(Z)-N'-(2,2-difluoroethyl)-3-propan-2-ylhex-2-enimidamide (PubChem CID 169247287) has the molecular formula C11H20F2N2 and a molecular weight of 218.29 g/mol. Its IUPAC name is (Z)-N'-(2,2-difluoroethyl)-3-propan-2-ylhex-2-enimidamide.
| Compound Name | (Z)-N'-(2,2-difluoroethyl)-3-propan-2-ylhex-2-enimidamide |
|---|---|
| PubChem CID | 169247287 |
| Molecular Formula | C11H20F2N2 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | (Z)-N'-(2,2-difluoroethyl)-3-propan-2-ylhex-2-enimidamide |
| SMILES | CCC/C(=C/C(N)=N/CC(F)F)C(C)C |
| InChI | InChI=1S/C11H20F2N2/c1-4-5-9(8(2)3)6-11(14)15-7-10(12)13/h6,8,10H,4-5,7H2,1-3H3,(H2,14,15)/b9-6- |
| InChIKey | AIYWGWVYPLPTGT-TWGQIWQCSA-N |
| XLogP | 2.99 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|