C15H24F3N3 — CID 123333823
(6E)-3-methyl-8-(2-methylpentan-3-ylimino)-7-(trifluoromethyl)-4,5-dihydro-3H-azocin-2-amine (PubChem CID 123333823) has the molecular formula C15H24F3N3 and a molecular weight of 303.37 g/mol. Its IUPAC name is (6E)-3-methyl-8-(2-methylpentan-3-ylimino)-7-(trifluoromethyl)-4,5-dihydro-3H-azocin-2-amine.
| Compound Name | (6E)-3-methyl-8-(2-methylpentan-3-ylimino)-7-(trifluoromethyl)-4,5-dihydro-3H-azocin-2-amine |
|---|---|
| PubChem CID | 123333823 |
| Molecular Formula | C15H24F3N3 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (6E)-3-methyl-8-(2-methylpentan-3-ylimino)-7-(trifluoromethyl)-4,5-dihydro-3H-azocin-2-amine |
| SMILES | CCC(/N=C1\N=C(\N)C(C)CC/C=C\1C(F)(F)F)C(C)C |
| InChI | InChI=1S/C15H24F3N3/c1-5-12(9(2)3)20-14-11(15(16,17)18)8-6-7-10(4)13(19)21-14/h8-10,12H,5-7H2,1-4H3,(H2,19,20,21)/b11-8+ |
| InChIKey | WZAGQUIFVUGJNV-DHZHZOJOSA-N |
| XLogP | 4.10 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|