C12H20F2N2 — CID 169247484
(E)-N'-[(Z)-1,1-difluoropent-2-en-2-yl]-3-methylhex-2-enimidamide (PubChem CID 169247484) has the molecular formula C12H20F2N2 and a molecular weight of 230.30 g/mol. Its IUPAC name is (E)-N'-[(Z)-1,1-difluoropent-2-en-2-yl]-3-methylhex-2-enimidamide.
| Compound Name | (E)-N'-[(Z)-1,1-difluoropent-2-en-2-yl]-3-methylhex-2-enimidamide |
|---|---|
| PubChem CID | 169247484 |
| Molecular Formula | C12H20F2N2 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | (E)-N'-[(Z)-1,1-difluoropent-2-en-2-yl]-3-methylhex-2-enimidamide |
| SMILES | CC/C=C(\N=C(N)\C=C(/C)CCC)C(F)F |
| InChI | InChI=1S/C12H20F2N2/c1-4-6-9(3)8-11(15)16-10(7-5-2)12(13)14/h7-8,12H,4-6H2,1-3H3,(H2,15,16)/b9-8+,10-7- |
| InChIKey | PEOCITDMLAPFLX-AZRUORMVSA-N |
| XLogP | 3.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|