C10H17F3N2 — CID 170150378
2-methyl-N'-[(Z)-1,1,1-trifluorohex-2-en-2-yl]propanimidamide (PubChem CID 170150378) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-methyl-N'-[(Z)-1,1,1-trifluorohex-2-en-2-yl]propanimidamide.
| Compound Name | 2-methyl-N'-[(Z)-1,1,1-trifluorohex-2-en-2-yl]propanimidamide |
|---|---|
| PubChem CID | 170150378 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-methyl-N'-[(Z)-1,1,1-trifluorohex-2-en-2-yl]propanimidamide |
| SMILES | CCC/C=C(\N=C(\N)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2/c1-4-5-6-8(10(11,12)13)15-9(14)7(2)3/h6-7H,4-5H2,1-3H3,(H2,14,15)/b8-6- |
| InChIKey | HIBJRTDYKCTBFT-VURMDHGXSA-N |
| XLogP | 3.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|